C22H15F3N2O3 — CID 54467924
N-[3-(2-nitroethenyl)phenyl]-2-[4-(trifluoromethyl)phenyl]benzamide (PubChem CID 54467924) has the molecular formula C22H15F3N2O3 and a molecular weight of 412.37 g/mol. Its IUPAC name is N-[3-(2-nitroethenyl)phenyl]-2-[4-(trifluoromethyl)phenyl]benzamide.
| Compound Name | N-[3-(2-nitroethenyl)phenyl]-2-[4-(trifluoromethyl)phenyl]benzamide |
|---|---|
| PubChem CID | 54467924 |
| Molecular Formula | C22H15F3N2O3 |
| Molecular Weight | 412.37 g/mol |
| Exact Mass | 412.10 |
| IUPAC Name | N-[3-(2-nitroethenyl)phenyl]-2-[4-(trifluoromethyl)phenyl]benzamide |
| SMILES | O=C(Nc1cccc(C=C[N+](=O)[O-])c1)c1ccccc1-c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C22H15F3N2O3/c23-22(24,25)17-10-8-16(9-11-17)19-6-1-2-7-20(19)21(28)26-18-5-3-4-15(14-18)12-13-27(29)30/h1-14H,(H,26,28) |
| InChIKey | XGGVJPHZUPWFME-UHFFFAOYSA-N |
| XLogP | 5.87 |
| TPSA | 72.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.37 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|