C22H16F3N3O3 — CID 69474826
2-[2-(4-amino-3-nitrophenyl)ethenyl]-N-[3-(trifluoromethyl)phenyl]benzamide (PubChem CID 69474826) has the molecular formula C22H16F3N3O3 and a molecular weight of 427.38 g/mol. Its IUPAC name is 2-[2-(4-amino-3-nitrophenyl)ethenyl]-N-[3-(trifluoromethyl)phenyl]benzamide.
| Compound Name | 2-[2-(4-amino-3-nitrophenyl)ethenyl]-N-[3-(trifluoromethyl)phenyl]benzamide |
|---|---|
| PubChem CID | 69474826 |
| Molecular Formula | C22H16F3N3O3 |
| Molecular Weight | 427.38 g/mol |
| Exact Mass | 427.11 |
| IUPAC Name | 2-[2-(4-amino-3-nitrophenyl)ethenyl]-N-[3-(trifluoromethyl)phenyl]benzamide |
| SMILES | Nc1ccc(C=Cc2ccccc2C(=O)Nc2cccc(C(F)(F)F)c2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C22H16F3N3O3/c23-22(24,25)16-5-3-6-17(13-16)27-21(29)18-7-2-1-4-15(18)10-8-14-9-11-19(26)20(12-14)28(30)31/h1-13H,26H2,(H,27,29) |
| InChIKey | YLEGLYJMLVVEBH-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 98.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.38 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|