C24H16F3N2NaO3 — CID 68952931
sodium 1-methyl-5-[[2-[4-(trifluoromethyl)phenyl]benzoyl]amino]indole-2-carboxylate (PubChem CID 68952931) has the molecular formula C24H16F3N2NaO3 and a molecular weight of 460.39 g/mol. Its IUPAC name is sodium 1-methyl-5-[[2-[4-(trifluoromethyl)phenyl]benzoyl]amino]indole-2-carboxylate.
| Compound Name | sodium 1-methyl-5-[[2-[4-(trifluoromethyl)phenyl]benzoyl]amino]indole-2-carboxylate |
|---|---|
| PubChem CID | 68952931 |
| Molecular Formula | C24H16F3N2NaO3 |
| Molecular Weight | 460.39 g/mol |
| Exact Mass | 460.10 |
| IUPAC Name | sodium 1-methyl-5-[[2-[4-(trifluoromethyl)phenyl]benzoyl]amino]indole-2-carboxylate |
| SMILES | Cn1c(C(=O)[O-])cc2cc(NC(=O)c3ccccc3-c3ccc(C(F)(F)F)cc3)ccc21.[Na+] |
| InChI | InChI=1S/C24H17F3N2O3.Na/c1-29-20-11-10-17(12-15(20)13-21(29)23(31)32)28-22(30)19-5-3-2-4-18(19)14-6-8-16(9-7-14)24(25,26)27;/h2-13H,1H3,(H,28,30)(H,31,32);/q;+1/p-1 |
| InChIKey | DWLONIGJWBRCHR-UHFFFAOYSA-M |
| XLogP | 1.48 |
| TPSA | 74.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.39 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |