C30H22ClF3N2O2 — CID 139944370
N-[2-(2-chloro-2-phenylacetyl)-1,3-dihydroisoindol-5-yl]-2-[4-(trifluoromethyl)phenyl]benzamide (PubChem CID 139944370) has the molecular formula C30H22ClF3N2O2 and a molecular weight of 534.97 g/mol. Its IUPAC name is N-[2-(2-chloro-2-phenylacetyl)-1,3-dihydroisoindol-5-yl]-2-[4-(trifluoromethyl)phenyl]benzamide.
| Compound Name | N-[2-(2-chloro-2-phenylacetyl)-1,3-dihydroisoindol-5-yl]-2-[4-(trifluoromethyl)phenyl]benzamide |
|---|---|
| PubChem CID | 139944370 |
| Molecular Formula | C30H22ClF3N2O2 |
| Molecular Weight | 534.97 g/mol |
| Exact Mass | 534.13 |
| IUPAC Name | N-[2-(2-chloro-2-phenylacetyl)-1,3-dihydroisoindol-5-yl]-2-[4-(trifluoromethyl)phenyl]benzamide |
| SMILES | O=C(Nc1ccc2c(c1)CN(C(=O)C(Cl)c1ccccc1)C2)c1ccccc1-c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C30H22ClF3N2O2/c31-27(20-6-2-1-3-7-20)29(38)36-17-21-12-15-24(16-22(21)18-36)35-28(37)26-9-5-4-8-25(26)19-10-13-23(14-11-19)30(32,33)34/h1-16,27H,17-18H2,(H,35,37) |
| InChIKey | FOAVZEZWFLGPSD-UHFFFAOYSA-N |
| XLogP | 7.45 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.97 |
| LogP ≤ 5 | 7.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|