C34H34F3N3O3 — CID 58741390
propyl 2-phenyl-2-[3-[4-[[2-[4-(trifluoromethyl)phenyl]benzoyl]amino]anilino]propylamino]acetate (PubChem CID 58741390) has the molecular formula C34H34F3N3O3 and a molecular weight of 589.66 g/mol. Its IUPAC name is propyl 2-phenyl-2-[3-[4-[[2-[4-(trifluoromethyl)phenyl]benzoyl]amino]anilino]propylamino]acetate.
| Compound Name | propyl 2-phenyl-2-[3-[4-[[2-[4-(trifluoromethyl)phenyl]benzoyl]amino]anilino]propylamino]acetate |
|---|---|
| PubChem CID | 58741390 |
| Molecular Formula | C34H34F3N3O3 |
| Molecular Weight | 589.66 g/mol |
| Exact Mass | 589.26 |
| IUPAC Name | propyl 2-phenyl-2-[3-[4-[[2-[4-(trifluoromethyl)phenyl]benzoyl]amino]anilino]propylamino]acetate |
| SMILES | CCCOC(=O)C(NCCCNc1ccc(NC(=O)c2ccccc2-c2ccc(C(F)(F)F)cc2)cc1)c1ccccc1 |
| InChI | InChI=1S/C34H34F3N3O3/c1-2-23-43-33(42)31(25-9-4-3-5-10-25)39-22-8-21-38-27-17-19-28(20-18-27)40-32(41)30-12-7-6-11-29(30)24-13-15-26(16-14-24)34(35,36)37/h3-7,9-20,31,38-39H,2,8,21-23H2,1H3,(H,40,41) |
| InChIKey | ZYHHROYAVRADNP-UHFFFAOYSA-N |
| XLogP | 7.71 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.66 |
| LogP ≤ 5 | 7.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|