C35H36F3N3O3 — CID 58741396
propyl 2-[methyl-[2-[N-methyl-4-[[2-[4-(trifluoromethyl)phenyl]benzoyl]amino]anilino]ethyl]amino]-2-phenylacetate (PubChem CID 58741396) has the molecular formula C35H36F3N3O3 and a molecular weight of 603.69 g/mol. Its IUPAC name is propyl 2-[methyl-[2-[N-methyl-4-[[2-[4-(trifluoromethyl)phenyl]benzoyl]amino]anilino]ethyl]amino]-2-phenylacetate.
| Compound Name | propyl 2-[methyl-[2-[N-methyl-4-[[2-[4-(trifluoromethyl)phenyl]benzoyl]amino]anilino]ethyl]amino]-2-phenylacetate |
|---|---|
| PubChem CID | 58741396 |
| Molecular Formula | C35H36F3N3O3 |
| Molecular Weight | 603.69 g/mol |
| Exact Mass | 603.27 |
| IUPAC Name | propyl 2-[methyl-[2-[N-methyl-4-[[2-[4-(trifluoromethyl)phenyl]benzoyl]amino]anilino]ethyl]amino]-2-phenylacetate |
| SMILES | CCCOC(=O)C(c1ccccc1)N(C)CCN(C)c1ccc(NC(=O)c2ccccc2-c2ccc(C(F)(F)F)cc2)cc1 |
| InChI | InChI=1S/C35H36F3N3O3/c1-4-24-44-34(43)32(26-10-6-5-7-11-26)41(3)23-22-40(2)29-20-18-28(19-21-29)39-33(42)31-13-9-8-12-30(31)25-14-16-27(17-15-25)35(36,37)38/h5-21,32H,4,22-24H2,1-3H3,(H,39,42) |
| InChIKey | PDWILDQHKZNHLV-UHFFFAOYSA-N |
| XLogP | 7.69 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.69 |
| LogP ≤ 5 | 7.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|