C8H4Cl2F3NO3S — CID 134087949
2,6-dichloro-N-(trifluoromethylsulfonyl)benzamide (PubChem CID 134087949) has the molecular formula C8H4Cl2F3NO3S and a molecular weight of 322.09 g/mol. Its IUPAC name is 2,6-dichloro-N-(trifluoromethylsulfonyl)benzamide.
| Compound Name | 2,6-dichloro-N-(trifluoromethylsulfonyl)benzamide |
|---|---|
| PubChem CID | 134087949 |
| Molecular Formula | C8H4Cl2F3NO3S |
| Molecular Weight | 322.09 g/mol |
| Exact Mass | 320.92 |
| IUPAC Name | 2,6-dichloro-N-(trifluoromethylsulfonyl)benzamide |
| SMILES | O=C(NS(=O)(=O)C(F)(F)F)c1c(Cl)cccc1Cl |
| InChI | InChI=1S/C8H4Cl2F3NO3S/c9-4-2-1-3-5(10)6(4)7(15)14-18(16,17)8(11,12)13/h1-3H,(H,14,15) |
| InChIKey | MSKQPQDJRWSSAL-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.09 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |