C26H24F3N3O3S — CID 43878312
3-[(4-butan-2-yloxybenzoyl)carbamothioylamino]-N-[3-(trifluoromethyl)phenyl]benzamide (PubChem CID 43878312) has the molecular formula C26H24F3N3O3S and a molecular weight of 515.56 g/mol. Its IUPAC name is 3-[(4-butan-2-yloxybenzoyl)carbamothioylamino]-N-[3-(trifluoromethyl)phenyl]benzamide.
| Compound Name | 3-[(4-butan-2-yloxybenzoyl)carbamothioylamino]-N-[3-(trifluoromethyl)phenyl]benzamide |
|---|---|
| PubChem CID | 43878312 |
| Molecular Formula | C26H24F3N3O3S |
| Molecular Weight | 515.56 g/mol |
| Exact Mass | 515.15 |
| IUPAC Name | 3-[(4-butan-2-yloxybenzoyl)carbamothioylamino]-N-[3-(trifluoromethyl)phenyl]benzamide |
| SMILES | CCC(C)Oc1ccc(C(=O)NC(=S)Nc2cccc(C(=O)Nc3cccc(C(F)(F)F)c3)c2)cc1 |
| InChI | InChI=1S/C26H24F3N3O3S/c1-3-16(2)35-22-12-10-17(11-13-22)23(33)32-25(36)31-20-8-4-6-18(14-20)24(34)30-21-9-5-7-19(15-21)26(27,28)29/h4-16H,3H2,1-2H3,(H,30,34)(H2,31,32,33,36) |
| InChIKey | IJOLNYJSLAKTCP-UHFFFAOYSA-N |
| XLogP | 6.26 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.56 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|