C14H18F3N3OS3 — CID 5214306
1-[[2,2-bis(ethylsulfanyl)acetyl]amino]-3-[3-(trifluoromethyl)phenyl]thiourea (PubChem CID 5214306) has the molecular formula C14H18F3N3OS3 and a molecular weight of 397.51 g/mol. Its IUPAC name is 1-[[2,2-bis(ethylsulfanyl)acetyl]amino]-3-[3-(trifluoromethyl)phenyl]thiourea.
| Compound Name | 1-[[2,2-bis(ethylsulfanyl)acetyl]amino]-3-[3-(trifluoromethyl)phenyl]thiourea |
|---|---|
| PubChem CID | 5214306 |
| Molecular Formula | C14H18F3N3OS3 |
| Molecular Weight | 397.51 g/mol |
| Exact Mass | 397.06 |
| IUPAC Name | 1-[[2,2-bis(ethylsulfanyl)acetyl]amino]-3-[3-(trifluoromethyl)phenyl]thiourea |
| SMILES | CCSC(SCC)C(=O)NNC(=S)Nc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C14H18F3N3OS3/c1-3-23-12(24-4-2)11(21)19-20-13(22)18-10-7-5-6-9(8-10)14(15,16)17/h5-8,12H,3-4H2,1-2H3,(H,19,21)(H2,18,20,22) |
| InChIKey | YPDJQTCLARBOBI-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 53.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.51 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|