C11H9F3N4OS — CID 153489287
1-[(2-isocyanoacetyl)amino]-3-[3-(trifluoromethyl)phenyl]thiourea (PubChem CID 153489287) has the molecular formula C11H9F3N4OS and a molecular weight of 302.28 g/mol. Its IUPAC name is 1-[(2-isocyanoacetyl)amino]-3-[3-(trifluoromethyl)phenyl]thiourea.
| Compound Name | 1-[(2-isocyanoacetyl)amino]-3-[3-(trifluoromethyl)phenyl]thiourea |
|---|---|
| PubChem CID | 153489287 |
| Molecular Formula | C11H9F3N4OS |
| Molecular Weight | 302.28 g/mol |
| Exact Mass | 302.04 |
| IUPAC Name | 1-[(2-isocyanoacetyl)amino]-3-[3-(trifluoromethyl)phenyl]thiourea |
| SMILES | [C-]#[N+]CC(=O)NNC(=S)Nc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C11H9F3N4OS/c1-15-6-9(19)17-18-10(20)16-8-4-2-3-7(5-8)11(12,13)14/h2-5H,6H2,(H,17,19)(H2,16,18,20) |
| InChIKey | UVMLMLNHGAHYBR-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 57.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.28 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|