C19H16F3N3O2S — CID 2807574
1-[[2-(2-methyl-1-benzofuran-3-yl)acetyl]amino]-3-[3-(trifluoromethyl)phenyl]thiourea (PubChem CID 2807574) has the molecular formula C19H16F3N3O2S and a molecular weight of 407.42 g/mol. Its IUPAC name is 1-[[2-(2-methyl-1-benzofuran-3-yl)acetyl]amino]-3-[3-(trifluoromethyl)phenyl]thiourea.
| Compound Name | 1-[[2-(2-methyl-1-benzofuran-3-yl)acetyl]amino]-3-[3-(trifluoromethyl)phenyl]thiourea |
|---|---|
| PubChem CID | 2807574 |
| Molecular Formula | C19H16F3N3O2S |
| Molecular Weight | 407.42 g/mol |
| Exact Mass | 407.09 |
| IUPAC Name | 1-[[2-(2-methyl-1-benzofuran-3-yl)acetyl]amino]-3-[3-(trifluoromethyl)phenyl]thiourea |
| SMILES | Cc1oc2ccccc2c1CC(=O)NNC(=S)Nc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C19H16F3N3O2S/c1-11-15(14-7-2-3-8-16(14)27-11)10-17(26)24-25-18(28)23-13-6-4-5-12(9-13)19(20,21)22/h2-9H,10H2,1H3,(H,24,26)(H2,23,25,28) |
| InChIKey | GBZYRNZTNJYWLF-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 66.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.42 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|