C24H20F3N3O2S — CID 28639647
4-[[2-(2-methylphenyl)acetyl]carbamothioylamino]-N-[3-(trifluoromethyl)phenyl]benzamide (PubChem CID 28639647) has the molecular formula C24H20F3N3O2S and a molecular weight of 471.50 g/mol. Its IUPAC name is 4-[[2-(2-methylphenyl)acetyl]carbamothioylamino]-N-[3-(trifluoromethyl)phenyl]benzamide.
| Compound Name | 4-[[2-(2-methylphenyl)acetyl]carbamothioylamino]-N-[3-(trifluoromethyl)phenyl]benzamide |
|---|---|
| PubChem CID | 28639647 |
| Molecular Formula | C24H20F3N3O2S |
| Molecular Weight | 471.50 g/mol |
| Exact Mass | 471.12 |
| IUPAC Name | 4-[[2-(2-methylphenyl)acetyl]carbamothioylamino]-N-[3-(trifluoromethyl)phenyl]benzamide |
| SMILES | Cc1ccccc1CC(=O)NC(=S)Nc1ccc(C(=O)Nc2cccc(C(F)(F)F)c2)cc1 |
| InChI | InChI=1S/C24H20F3N3O2S/c1-15-5-2-3-6-17(15)13-21(31)30-23(33)29-19-11-9-16(10-12-19)22(32)28-20-8-4-7-18(14-20)24(25,26)27/h2-12,14H,13H2,1H3,(H,28,32)(H2,29,30,31,33) |
| InChIKey | XKMLEOUPIURDLB-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.50 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|