C25H24N4O3S — CID 26164336
3-methyl-N-[4-[[[2-(2-methylphenyl)acetyl]carbamothioylamino]carbamoyl]phenyl]benzamide (PubChem CID 26164336) has the molecular formula C25H24N4O3S and a molecular weight of 460.56 g/mol. Its IUPAC name is 3-methyl-N-[4-[[[2-(2-methylphenyl)acetyl]carbamothioylamino]carbamoyl]phenyl]benzamide.
| Compound Name | 3-methyl-N-[4-[[[2-(2-methylphenyl)acetyl]carbamothioylamino]carbamoyl]phenyl]benzamide |
|---|---|
| PubChem CID | 26164336 |
| Molecular Formula | C25H24N4O3S |
| Molecular Weight | 460.56 g/mol |
| Exact Mass | 460.16 |
| IUPAC Name | 3-methyl-N-[4-[[[2-(2-methylphenyl)acetyl]carbamothioylamino]carbamoyl]phenyl]benzamide |
| SMILES | Cc1cccc(C(=O)Nc2ccc(C(=O)NNC(=S)NC(=O)Cc3ccccc3C)cc2)c1 |
| InChI | InChI=1S/C25H24N4O3S/c1-16-6-5-9-20(14-16)23(31)26-21-12-10-18(11-13-21)24(32)28-29-25(33)27-22(30)15-19-8-4-3-7-17(19)2/h3-14H,15H2,1-2H3,(H,26,31)(H,28,32)(H2,27,29,30,33) |
| InChIKey | KKBAPWPOMLGQEF-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 99.33 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.56 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|