C27H29N3O2S — CID 26164225
4-tert-butyl-N-[4-[[2-(2-methylphenyl)acetyl]carbamothioylamino]phenyl]benzamide (PubChem CID 26164225) has the molecular formula C27H29N3O2S and a molecular weight of 459.62 g/mol. Its IUPAC name is 4-tert-butyl-N-[4-[[2-(2-methylphenyl)acetyl]carbamothioylamino]phenyl]benzamide.
| Compound Name | 4-tert-butyl-N-[4-[[2-(2-methylphenyl)acetyl]carbamothioylamino]phenyl]benzamide |
|---|---|
| PubChem CID | 26164225 |
| Molecular Formula | C27H29N3O2S |
| Molecular Weight | 459.62 g/mol |
| Exact Mass | 459.20 |
| IUPAC Name | 4-tert-butyl-N-[4-[[2-(2-methylphenyl)acetyl]carbamothioylamino]phenyl]benzamide |
| SMILES | Cc1ccccc1CC(=O)NC(=S)Nc1ccc(NC(=O)c2ccc(C(C)(C)C)cc2)cc1 |
| InChI | InChI=1S/C27H29N3O2S/c1-18-7-5-6-8-20(18)17-24(31)30-26(33)29-23-15-13-22(14-16-23)28-25(32)19-9-11-21(12-10-19)27(2,3)4/h5-16H,17H2,1-4H3,(H,28,32)(H2,29,30,31,33) |
| InChIKey | NXORVMPDNFOVEF-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.62 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|