C21H25N3O2S — CID 26164162
N-tert-butyl-4-[[2-(2-methylphenyl)acetyl]carbamothioylamino]benzamide (PubChem CID 26164162) has the molecular formula C21H25N3O2S and a molecular weight of 383.52 g/mol. Its IUPAC name is N-tert-butyl-4-[[2-(2-methylphenyl)acetyl]carbamothioylamino]benzamide.
| Compound Name | N-tert-butyl-4-[[2-(2-methylphenyl)acetyl]carbamothioylamino]benzamide |
|---|---|
| PubChem CID | 26164162 |
| Molecular Formula | C21H25N3O2S |
| Molecular Weight | 383.52 g/mol |
| Exact Mass | 383.17 |
| IUPAC Name | N-tert-butyl-4-[[2-(2-methylphenyl)acetyl]carbamothioylamino]benzamide |
| SMILES | Cc1ccccc1CC(=O)NC(=S)Nc1ccc(C(=O)NC(C)(C)C)cc1 |
| InChI | InChI=1S/C21H25N3O2S/c1-14-7-5-6-8-16(14)13-18(25)23-20(27)22-17-11-9-15(10-12-17)19(26)24-21(2,3)4/h5-12H,13H2,1-4H3,(H,24,26)(H2,22,23,25,27) |
| InChIKey | VENWXZLCVYJSEI-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.52 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|