C23H18F3N3O2S — CID 26168214
3-[(2-phenylacetyl)carbamothioylamino]-N-[3-(trifluoromethyl)phenyl]benzamide (PubChem CID 26168214) has the molecular formula C23H18F3N3O2S and a molecular weight of 457.48 g/mol. Its IUPAC name is 3-[(2-phenylacetyl)carbamothioylamino]-N-[3-(trifluoromethyl)phenyl]benzamide.
| Compound Name | 3-[(2-phenylacetyl)carbamothioylamino]-N-[3-(trifluoromethyl)phenyl]benzamide |
|---|---|
| PubChem CID | 26168214 |
| Molecular Formula | C23H18F3N3O2S |
| Molecular Weight | 457.48 g/mol |
| Exact Mass | 457.11 |
| IUPAC Name | 3-[(2-phenylacetyl)carbamothioylamino]-N-[3-(trifluoromethyl)phenyl]benzamide |
| SMILES | O=C(Cc1ccccc1)NC(=S)Nc1cccc(C(=O)Nc2cccc(C(F)(F)F)c2)c1 |
| InChI | InChI=1S/C23H18F3N3O2S/c24-23(25,26)17-9-5-11-19(14-17)27-21(31)16-8-4-10-18(13-16)28-22(32)29-20(30)12-15-6-2-1-3-7-15/h1-11,13-14H,12H2,(H,27,31)(H2,28,29,30,32) |
| InChIKey | LDHZWNXCDMAIJV-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.48 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|