C22H25F3N2O2S — CID 19188759
4-(4-tert-butylphenoxy)-N-[[3-(trifluoromethyl)phenyl]carbamothioyl]butanamide (PubChem CID 19188759) has the molecular formula C22H25F3N2O2S and a molecular weight of 438.52 g/mol. Its IUPAC name is 4-(4-tert-butylphenoxy)-N-[[3-(trifluoromethyl)phenyl]carbamothioyl]butanamide.
| Compound Name | 4-(4-tert-butylphenoxy)-N-[[3-(trifluoromethyl)phenyl]carbamothioyl]butanamide |
|---|---|
| PubChem CID | 19188759 |
| Molecular Formula | C22H25F3N2O2S |
| Molecular Weight | 438.52 g/mol |
| Exact Mass | 438.16 |
| IUPAC Name | 4-(4-tert-butylphenoxy)-N-[[3-(trifluoromethyl)phenyl]carbamothioyl]butanamide |
| SMILES | CC(C)(C)c1ccc(OCCCC(=O)NC(=S)Nc2cccc(C(F)(F)F)c2)cc1 |
| InChI | InChI=1S/C22H25F3N2O2S/c1-21(2,3)15-9-11-18(12-10-15)29-13-5-8-19(28)27-20(30)26-17-7-4-6-16(14-17)22(23,24)25/h4,6-7,9-12,14H,5,8,13H2,1-3H3,(H2,26,27,28,30) |
| InChIKey | HQAYUMUFYIOGRZ-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.52 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|