C18H21N3O5 — CID 639703
2-[4-[(4-amino-2-methoxyphenyl)carbamoylamino]phenoxy]-2-methylpropanoic acid (PubChem CID 639703) has the molecular formula C18H21N3O5 and a molecular weight of 359.38 g/mol. Its IUPAC name is 2-[4-[(4-amino-2-methoxyphenyl)carbamoylamino]phenoxy]-2-methylpropanoic acid.
| Compound Name | 2-[4-[(4-amino-2-methoxyphenyl)carbamoylamino]phenoxy]-2-methylpropanoic acid |
|---|---|
| PubChem CID | 639703 |
| Molecular Formula | C18H21N3O5 |
| Molecular Weight | 359.38 g/mol |
| Exact Mass | 359.15 |
| IUPAC Name | 2-[4-[(4-amino-2-methoxyphenyl)carbamoylamino]phenoxy]-2-methylpropanoic acid |
| SMILES | COc1cc(N)ccc1NC(=O)Nc1ccc(OC(C)(C)C(=O)O)cc1 |
| InChI | InChI=1S/C18H21N3O5/c1-18(2,16(22)23)26-13-7-5-12(6-8-13)20-17(24)21-14-9-4-11(19)10-15(14)25-3/h4-10H,19H2,1-3H3,(H,22,23)(H2,20,21,24) |
| InChIKey | WGTDQUCOSOGZFY-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 122.91 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.38 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|