C22H21F3N6O4S — CID 24949372
tert-butyl N-[3-[5-[[[4-(trifluoromethyl)phenyl]carbamothioylamino]carbamoyl]-1,2,4-oxadiazol-3-yl]phenyl]carbamate (PubChem CID 24949372) has the molecular formula C22H21F3N6O4S and a molecular weight of 522.51 g/mol. Its IUPAC name is tert-butyl N-[3-[5-[[[4-(trifluoromethyl)phenyl]carbamothioylamino]carbamoyl]-1,2,4-oxadiazol-3-yl]phenyl]carbamate.
| Compound Name | tert-butyl N-[3-[5-[[[4-(trifluoromethyl)phenyl]carbamothioylamino]carbamoyl]-1,2,4-oxadiazol-3-yl]phenyl]carbamate |
|---|---|
| PubChem CID | 24949372 |
| Molecular Formula | C22H21F3N6O4S |
| Molecular Weight | 522.51 g/mol |
| Exact Mass | 522.13 |
| IUPAC Name | tert-butyl N-[3-[5-[[[4-(trifluoromethyl)phenyl]carbamothioylamino]carbamoyl]-1,2,4-oxadiazol-3-yl]phenyl]carbamate |
| SMILES | CC(C)(C)OC(=O)Nc1cccc(-c2noc(C(=O)NNC(=S)Nc3ccc(C(F)(F)F)cc3)n2)c1 |
| InChI | InChI=1S/C22H21F3N6O4S/c1-21(2,3)34-20(33)27-15-6-4-5-12(11-15)16-28-18(35-31-16)17(32)29-30-19(36)26-14-9-7-13(8-10-14)22(23,24)25/h4-11H,1-3H3,(H,27,33)(H,29,32)(H2,26,30,36) |
| InChIKey | DYGFEHHDEYKYEJ-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 130.41 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.51 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|