C21H20F3N5O2S — CID 24949066
1-[[3-(4-tert-butylphenyl)-1,2,4-oxadiazole-5-carbonyl]amino]-3-[4-(trifluoromethyl)phenyl]thiourea (PubChem CID 24949066) has the molecular formula C21H20F3N5O2S and a molecular weight of 463.49 g/mol. Its IUPAC name is 1-[[3-(4-tert-butylphenyl)-1,2,4-oxadiazole-5-carbonyl]amino]-3-[4-(trifluoromethyl)phenyl]thiourea.
| Compound Name | 1-[[3-(4-tert-butylphenyl)-1,2,4-oxadiazole-5-carbonyl]amino]-3-[4-(trifluoromethyl)phenyl]thiourea |
|---|---|
| PubChem CID | 24949066 |
| Molecular Formula | C21H20F3N5O2S |
| Molecular Weight | 463.49 g/mol |
| Exact Mass | 463.13 |
| IUPAC Name | 1-[[3-(4-tert-butylphenyl)-1,2,4-oxadiazole-5-carbonyl]amino]-3-[4-(trifluoromethyl)phenyl]thiourea |
| SMILES | CC(C)(C)c1ccc(-c2noc(C(=O)NNC(=S)Nc3ccc(C(F)(F)F)cc3)n2)cc1 |
| InChI | InChI=1S/C21H20F3N5O2S/c1-20(2,3)13-6-4-12(5-7-13)16-26-18(31-29-16)17(30)27-28-19(32)25-15-10-8-14(9-11-15)21(22,23)24/h4-11H,1-3H3,(H,27,30)(H2,25,28,32) |
| InChIKey | NTQRKGUDNORNMZ-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 92.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.49 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|