C9H12BrClN2O2 — CID 131159794
N-(4-bromo-2-hydroxyphenyl)-2-(methylamino)acetamide;hydrochloride (PubChem CID 131159794) has the molecular formula C9H12BrClN2O2 and a molecular weight of 295.56 g/mol. Its IUPAC name is N-(4-bromo-2-hydroxyphenyl)-2-(methylamino)acetamide;hydrochloride.
| Compound Name | N-(4-bromo-2-hydroxyphenyl)-2-(methylamino)acetamide;hydrochloride |
|---|---|
| PubChem CID | 131159794 |
| Molecular Formula | C9H12BrClN2O2 |
| Molecular Weight | 295.56 g/mol |
| Exact Mass | 293.98 |
| IUPAC Name | N-(4-bromo-2-hydroxyphenyl)-2-(methylamino)acetamide;hydrochloride |
| SMILES | CNCC(=O)Nc1ccc(Br)cc1O.Cl |
| InChI | InChI=1S/C9H11BrN2O2.ClH/c1-11-5-9(14)12-7-3-2-6(10)4-8(7)13;/h2-4,11,13H,5H2,1H3,(H,12,14);1H |
| InChIKey | QQMGESXEPFQVJW-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.56 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|