C11H16BrN3O3S — CID 113000594
N-(4-bromo-2-methylphenyl)-2-(dimethylsulfamoylamino)acetamide (PubChem CID 113000594) has the molecular formula C11H16BrN3O3S and a molecular weight of 350.24 g/mol. Its IUPAC name is N-(4-bromo-2-methylphenyl)-2-(dimethylsulfamoylamino)acetamide.
| Compound Name | N-(4-bromo-2-methylphenyl)-2-(dimethylsulfamoylamino)acetamide |
|---|---|
| PubChem CID | 113000594 |
| Molecular Formula | C11H16BrN3O3S |
| Molecular Weight | 350.24 g/mol |
| Exact Mass | 349.01 |
| IUPAC Name | N-(4-bromo-2-methylphenyl)-2-(dimethylsulfamoylamino)acetamide |
| SMILES | Cc1cc(Br)ccc1NC(=O)CNS(=O)(=O)N(C)C |
| InChI | InChI=1S/C11H16BrN3O3S/c1-8-6-9(12)4-5-10(8)14-11(16)7-13-19(17,18)15(2)3/h4-6,13H,7H2,1-3H3,(H,14,16) |
| InChIKey | ZZELSMLUCSWMBY-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.24 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |