C27H24ClF3N4O3 — CID 87781204
3-[1-[4-[[[4-chloro-3-(trifluoromethyl)phenyl]-hydroxycarbamoyl]amino]phenyl]indol-5-yl]-2,2-dimethylpropanamide (PubChem CID 87781204) has the molecular formula C27H24ClF3N4O3 and a molecular weight of 544.96 g/mol. Its IUPAC name is 3-[1-[4-[[[4-chloro-3-(trifluoromethyl)phenyl]-hydroxycarbamoyl]amino]phenyl]indol-5-yl]-2,2-dimethylpropanamide.
| Compound Name | 3-[1-[4-[[[4-chloro-3-(trifluoromethyl)phenyl]-hydroxycarbamoyl]amino]phenyl]indol-5-yl]-2,2-dimethylpropanamide |
|---|---|
| PubChem CID | 87781204 |
| Molecular Formula | C27H24ClF3N4O3 |
| Molecular Weight | 544.96 g/mol |
| Exact Mass | 544.15 |
| IUPAC Name | 3-[1-[4-[[[4-chloro-3-(trifluoromethyl)phenyl]-hydroxycarbamoyl]amino]phenyl]indol-5-yl]-2,2-dimethylpropanamide |
| SMILES | CC(C)(Cc1ccc2c(ccn2-c2ccc(NC(=O)N(O)c3ccc(Cl)c(C(F)(F)F)c3)cc2)c1)C(N)=O |
| InChI | InChI=1S/C27H24ClF3N4O3/c1-26(2,24(32)36)15-16-3-10-23-17(13-16)11-12-34(23)19-6-4-18(5-7-19)33-25(37)35(38)20-8-9-22(28)21(14-20)27(29,30)31/h3-14,38H,15H2,1-2H3,(H2,32,36)(H,33,37) |
| InChIKey | JDGBXLGQQOQJCW-UHFFFAOYSA-N |
| XLogP | 6.78 |
| TPSA | 100.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.96 |
| LogP ≤ 5 | 6.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|