C20H16ClF3N6O2 — CID 123606230
3-[4-chloro-3-(trifluoromethyl)phenyl]-1-hydroxy-1-[3-(1-methyl-6H-purin-9-yl)phenyl]urea (PubChem CID 123606230) has the molecular formula C20H16ClF3N6O2 and a molecular weight of 464.84 g/mol. Its IUPAC name is 3-[4-chloro-3-(trifluoromethyl)phenyl]-1-hydroxy-1-[3-(1-methyl-6H-purin-9-yl)phenyl]urea.
| Compound Name | 3-[4-chloro-3-(trifluoromethyl)phenyl]-1-hydroxy-1-[3-(1-methyl-6H-purin-9-yl)phenyl]urea |
|---|---|
| PubChem CID | 123606230 |
| Molecular Formula | C20H16ClF3N6O2 |
| Molecular Weight | 464.84 g/mol |
| Exact Mass | 464.10 |
| IUPAC Name | 3-[4-chloro-3-(trifluoromethyl)phenyl]-1-hydroxy-1-[3-(1-methyl-6H-purin-9-yl)phenyl]urea |
| SMILES | CN1C=Nc2c(ncn2-c2cccc(N(O)C(=O)Nc3ccc(Cl)c(C(F)(F)F)c3)c2)C1 |
| InChI | InChI=1S/C20H16ClF3N6O2/c1-28-9-17-18(26-10-28)29(11-25-17)13-3-2-4-14(8-13)30(32)19(31)27-12-5-6-16(21)15(7-12)20(22,23)24/h2-8,10-11,32H,9H2,1H3,(H,27,31) |
| InChIKey | GOPRWGIYMGQAEU-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 85.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.84 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|