C16H12ClF3N4O — CID 38024054
N-[4-chloro-3-(trifluoromethyl)phenyl]-1-methyl-5-pyrrol-1-ylpyrazole-4-carboxamide (PubChem CID 38024054) has the molecular formula C16H12ClF3N4O and a molecular weight of 368.75 g/mol. Its IUPAC name is N-[4-chloro-3-(trifluoromethyl)phenyl]-1-methyl-5-pyrrol-1-ylpyrazole-4-carboxamide.
| Compound Name | N-[4-chloro-3-(trifluoromethyl)phenyl]-1-methyl-5-pyrrol-1-ylpyrazole-4-carboxamide |
|---|---|
| PubChem CID | 38024054 |
| Molecular Formula | C16H12ClF3N4O |
| Molecular Weight | 368.75 g/mol |
| Exact Mass | 368.07 |
| IUPAC Name | N-[4-chloro-3-(trifluoromethyl)phenyl]-1-methyl-5-pyrrol-1-ylpyrazole-4-carboxamide |
| SMILES | Cn1ncc(C(=O)Nc2ccc(Cl)c(C(F)(F)F)c2)c1-n1cccc1 |
| InChI | InChI=1S/C16H12ClF3N4O/c1-23-15(24-6-2-3-7-24)11(9-21-23)14(25)22-10-4-5-13(17)12(8-10)16(18,19)20/h2-9H,1H3,(H,22,25) |
| InChIKey | GKXDJNYUWMOXBZ-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 51.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.75 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |