C16H16N4O2 — CID 2809038
N-(3-methoxyphenyl)-1-methyl-5-pyrrol-1-ylpyrazole-4-carboxamide (PubChem CID 2809038) has the molecular formula C16H16N4O2 and a molecular weight of 296.33 g/mol. Its IUPAC name is N-(3-methoxyphenyl)-1-methyl-5-pyrrol-1-ylpyrazole-4-carboxamide.
| Compound Name | N-(3-methoxyphenyl)-1-methyl-5-pyrrol-1-ylpyrazole-4-carboxamide |
|---|---|
| PubChem CID | 2809038 |
| Molecular Formula | C16H16N4O2 |
| Molecular Weight | 296.33 g/mol |
| Exact Mass | 296.13 |
| IUPAC Name | N-(3-methoxyphenyl)-1-methyl-5-pyrrol-1-ylpyrazole-4-carboxamide |
| SMILES | COc1cccc(NC(=O)c2cnn(C)c2-n2cccc2)c1 |
| InChI | InChI=1S/C16H16N4O2/c1-19-16(20-8-3-4-9-20)14(11-17-19)15(21)18-12-6-5-7-13(10-12)22-2/h3-11H,1-2H3,(H,18,21) |
| InChIKey | BXSQTQGEIOKZMI-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 61.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.33 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |