C17H15ClN4O3 — CID 34163624
methyl 2-chloro-5-[(1-methyl-5-pyrrol-1-ylpyrazole-4-carbonyl)amino]benzoate (PubChem CID 34163624) has the molecular formula C17H15ClN4O3 and a molecular weight of 358.79 g/mol. Its IUPAC name is methyl 2-chloro-5-[(1-methyl-5-pyrrol-1-ylpyrazole-4-carbonyl)amino]benzoate.
| Compound Name | methyl 2-chloro-5-[(1-methyl-5-pyrrol-1-ylpyrazole-4-carbonyl)amino]benzoate |
|---|---|
| PubChem CID | 34163624 |
| Molecular Formula | C17H15ClN4O3 |
| Molecular Weight | 358.79 g/mol |
| Exact Mass | 358.08 |
| IUPAC Name | methyl 2-chloro-5-[(1-methyl-5-pyrrol-1-ylpyrazole-4-carbonyl)amino]benzoate |
| SMILES | COC(=O)c1cc(NC(=O)c2cnn(C)c2-n2cccc2)ccc1Cl |
| InChI | InChI=1S/C17H15ClN4O3/c1-21-16(22-7-3-4-8-22)13(10-19-21)15(23)20-11-5-6-14(18)12(9-11)17(24)25-2/h3-10H,1-2H3,(H,20,23) |
| InChIKey | RCRHIMJNAINVAK-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 78.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.79 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |