C13H14N6O — CID 38105120
1-methyl-N-(1-methylpyrazol-3-yl)-5-pyrrol-1-ylpyrazole-4-carboxamide (PubChem CID 38105120) has the molecular formula C13H14N6O and a molecular weight of 270.30 g/mol. Its IUPAC name is 1-methyl-N-(1-methylpyrazol-3-yl)-5-pyrrol-1-ylpyrazole-4-carboxamide.
| Compound Name | 1-methyl-N-(1-methylpyrazol-3-yl)-5-pyrrol-1-ylpyrazole-4-carboxamide |
|---|---|
| PubChem CID | 38105120 |
| Molecular Formula | C13H14N6O |
| Molecular Weight | 270.30 g/mol |
| Exact Mass | 270.12 |
| IUPAC Name | 1-methyl-N-(1-methylpyrazol-3-yl)-5-pyrrol-1-ylpyrazole-4-carboxamide |
| SMILES | Cn1ccc(NC(=O)c2cnn(C)c2-n2cccc2)n1 |
| InChI | InChI=1S/C13H14N6O/c1-17-8-5-11(16-17)15-12(20)10-9-14-18(2)13(10)19-6-3-4-7-19/h3-9H,1-2H3,(H,15,16,20) |
| InChIKey | GLESUHWNWXBVTC-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 69.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.30 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |