C19H12ClF3N6O — CID 23155299
1-[4-chloro-3-(trifluoromethyl)phenyl]-3-(4-purin-7-ylphenyl)urea (PubChem CID 23155299) has the molecular formula C19H12ClF3N6O and a molecular weight of 432.79 g/mol. Its IUPAC name is 1-[4-chloro-3-(trifluoromethyl)phenyl]-3-(4-purin-7-ylphenyl)urea.
| Compound Name | 1-[4-chloro-3-(trifluoromethyl)phenyl]-3-(4-purin-7-ylphenyl)urea |
|---|---|
| PubChem CID | 23155299 |
| Molecular Formula | C19H12ClF3N6O |
| Molecular Weight | 432.79 g/mol |
| Exact Mass | 432.07 |
| IUPAC Name | 1-[4-chloro-3-(trifluoromethyl)phenyl]-3-(4-purin-7-ylphenyl)urea |
| SMILES | O=C(Nc1ccc(-n2cnc3ncncc32)cc1)Nc1ccc(Cl)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C19H12ClF3N6O/c20-15-6-3-12(7-14(15)19(21,22)23)28-18(30)27-11-1-4-13(5-2-11)29-10-26-17-16(29)8-24-9-25-17/h1-10H,(H2,27,28,30) |
| InChIKey | MWZYBEVMLOVSBN-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 84.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.79 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |