C21H15ClF3N7O — CID 11363485
1-[4-(6-amino-8-ethenylpurin-9-yl)phenyl]-3-[4-chloro-3-(trifluoromethyl)phenyl]urea (PubChem CID 11363485) has the molecular formula C21H15ClF3N7O and a molecular weight of 473.85 g/mol. Its IUPAC name is 1-[4-(6-amino-8-ethenylpurin-9-yl)phenyl]-3-[4-chloro-3-(trifluoromethyl)phenyl]urea.
| Compound Name | 1-[4-(6-amino-8-ethenylpurin-9-yl)phenyl]-3-[4-chloro-3-(trifluoromethyl)phenyl]urea |
|---|---|
| PubChem CID | 11363485 |
| Molecular Formula | C21H15ClF3N7O |
| Molecular Weight | 473.85 g/mol |
| Exact Mass | 473.10 |
| IUPAC Name | 1-[4-(6-amino-8-ethenylpurin-9-yl)phenyl]-3-[4-chloro-3-(trifluoromethyl)phenyl]urea |
| SMILES | C=Cc1nc2c(N)ncnc2n1-c1ccc(NC(=O)Nc2ccc(Cl)c(C(F)(F)F)c2)cc1 |
| InChI | InChI=1S/C21H15ClF3N7O/c1-2-16-31-17-18(26)27-10-28-19(17)32(16)13-6-3-11(4-7-13)29-20(33)30-12-5-8-15(22)14(9-12)21(23,24)25/h2-10H,1H2,(H2,26,27,28)(H2,29,30,33) |
| InChIKey | LRPZFQWTYSEULT-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 110.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.85 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |