C25H26Cl2F3N9O2 — CID 69316308
(2S)-2,6-diamino-N-[9-[4-[[4-chloro-3-(trifluoromethyl)phenyl]carbamoylamino]phenyl]purin-6-yl]hexanamide;hydrochloride (PubChem CID 69316308) has the molecular formula C25H26Cl2F3N9O2 and a molecular weight of 612.44 g/mol. Its IUPAC name is (2S)-2,6-diamino-N-[9-[4-[[4-chloro-3-(trifluoromethyl)phenyl]carbamoylamino]phenyl]purin-6-yl]hexanamide;hydrochloride.
| Compound Name | (2S)-2,6-diamino-N-[9-[4-[[4-chloro-3-(trifluoromethyl)phenyl]carbamoylamino]phenyl]purin-6-yl]hexanamide;hydrochloride |
|---|---|
| PubChem CID | 69316308 |
| Molecular Formula | C25H26Cl2F3N9O2 |
| Molecular Weight | 612.44 g/mol |
| Exact Mass | 611.15 |
| IUPAC Name | (2S)-2,6-diamino-N-[9-[4-[[4-chloro-3-(trifluoromethyl)phenyl]carbamoylamino]phenyl]purin-6-yl]hexanamide;hydrochloride |
| SMILES | Cl.NCCCC[C@H](N)C(=O)Nc1ncnc2c1ncn2-c1ccc(NC(=O)Nc2ccc(Cl)c(C(F)(F)F)c2)cc1 |
| InChI | InChI=1S/C25H25ClF3N9O2.ClH/c26-18-9-6-15(11-17(18)25(27,28)29)36-24(40)35-14-4-7-16(8-5-14)38-13-34-20-21(32-12-33-22(20)38)37-23(39)19(31)3-1-2-10-30;/h4-9,11-13,19H,1-3,10,30-31H2,(H2,35,36,40)(H,32,33,37,39);1H/t19-;/m0./s1 |
| InChIKey | OYRCNVSNWOTLPD-FYZYNONXSA-N |
| XLogP | 4.95 |
| TPSA | 165.87 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.44 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|