C26H27N9O — CID 15986479
1-[4-(6-aminopurin-9-yl)phenyl]-3-[3-tert-butyl-1-(3-methylphenyl)pyrazol-5-yl]urea (PubChem CID 15986479) has the molecular formula C26H27N9O and a molecular weight of 481.56 g/mol. Its IUPAC name is 1-[4-(6-aminopurin-9-yl)phenyl]-3-[3-tert-butyl-1-(3-methylphenyl)pyrazol-5-yl]urea.
| Compound Name | 1-[4-(6-aminopurin-9-yl)phenyl]-3-[3-tert-butyl-1-(3-methylphenyl)pyrazol-5-yl]urea |
|---|---|
| PubChem CID | 15986479 |
| Molecular Formula | C26H27N9O |
| Molecular Weight | 481.56 g/mol |
| Exact Mass | 481.23 |
| IUPAC Name | 1-[4-(6-aminopurin-9-yl)phenyl]-3-[3-tert-butyl-1-(3-methylphenyl)pyrazol-5-yl]urea |
| SMILES | Cc1cccc(-n2nc(C(C)(C)C)cc2NC(=O)Nc2ccc(-n3cnc4c(N)ncnc43)cc2)c1 |
| InChI | InChI=1S/C26H27N9O/c1-16-6-5-7-19(12-16)35-21(13-20(33-35)26(2,3)4)32-25(36)31-17-8-10-18(11-9-17)34-15-30-22-23(27)28-14-29-24(22)34/h5-15H,1-4H3,(H2,27,28,29)(H2,31,32,36) |
| InChIKey | AFDUPESQCPPSRL-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 128.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.56 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |