C18H17F3N6S — CID 101468376
1-[3-pyridin-4-yl-2-(1H-1,2,4-triazol-5-yl)propyl]-3-[3-(trifluoromethyl)phenyl]thiourea (PubChem CID 101468376) has the molecular formula C18H17F3N6S and a molecular weight of 406.44 g/mol. Its IUPAC name is 1-[3-pyridin-4-yl-2-(1H-1,2,4-triazol-5-yl)propyl]-3-[3-(trifluoromethyl)phenyl]thiourea.
| Compound Name | 1-[3-pyridin-4-yl-2-(1H-1,2,4-triazol-5-yl)propyl]-3-[3-(trifluoromethyl)phenyl]thiourea |
|---|---|
| PubChem CID | 101468376 |
| Molecular Formula | C18H17F3N6S |
| Molecular Weight | 406.44 g/mol |
| Exact Mass | 406.12 |
| IUPAC Name | 1-[3-pyridin-4-yl-2-(1H-1,2,4-triazol-5-yl)propyl]-3-[3-(trifluoromethyl)phenyl]thiourea |
| SMILES | FC(F)(F)c1cccc(NC(=S)NCC(Cc2ccncc2)c2ncn[nH]2)c1 |
| InChI | InChI=1S/C18H17F3N6S/c19-18(20,21)14-2-1-3-15(9-14)26-17(28)23-10-13(16-24-11-25-27-16)8-12-4-6-22-7-5-12/h1-7,9,11,13H,8,10H2,(H2,23,26,28)(H,24,25,27) |
| InChIKey | ITKRQCSDJGPWEU-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 78.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.44 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|