C16H16F3N3 — CID 3421241
N'-propan-2-yl-N-[3-(trifluoromethyl)phenyl]pyridine-4-carboximidamide (PubChem CID 3421241) has the molecular formula C16H16F3N3 and a molecular weight of 307.32 g/mol. Its IUPAC name is N'-propan-2-yl-N-[3-(trifluoromethyl)phenyl]pyridine-4-carboximidamide.
| Compound Name | N'-propan-2-yl-N-[3-(trifluoromethyl)phenyl]pyridine-4-carboximidamide |
|---|---|
| PubChem CID | 3421241 |
| Molecular Formula | C16H16F3N3 |
| Molecular Weight | 307.32 g/mol |
| Exact Mass | 307.13 |
| IUPAC Name | N'-propan-2-yl-N-[3-(trifluoromethyl)phenyl]pyridine-4-carboximidamide |
| SMILES | CC(C)/N=C(/Nc1cccc(C(F)(F)F)c1)c1ccncc1 |
| InChI | InChI=1S/C16H16F3N3/c1-11(2)21-15(12-6-8-20-9-7-12)22-14-5-3-4-13(10-14)16(17,18)19/h3-11H,1-2H3,(H,21,22) |
| InChIKey | XWBVLOLKOWPFFJ-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 37.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.32 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|