C16H14BrClN2O4S2 — CID 19687683
dimethyl 5-[(4-bromo-3-chlorophenyl)carbamothioylamino]-3-methylthiophene-2,4-dicarboxylate (PubChem CID 19687683) has the molecular formula C16H14BrClN2O4S2 and a molecular weight of 477.79 g/mol. Its IUPAC name is dimethyl 5-[(4-bromo-3-chlorophenyl)carbamothioylamino]-3-methylthiophene-2,4-dicarboxylate.
| Compound Name | dimethyl 5-[(4-bromo-3-chlorophenyl)carbamothioylamino]-3-methylthiophene-2,4-dicarboxylate |
|---|---|
| PubChem CID | 19687683 |
| Molecular Formula | C16H14BrClN2O4S2 |
| Molecular Weight | 477.79 g/mol |
| Exact Mass | 475.93 |
| IUPAC Name | dimethyl 5-[(4-bromo-3-chlorophenyl)carbamothioylamino]-3-methylthiophene-2,4-dicarboxylate |
| SMILES | COC(=O)c1sc(NC(=S)Nc2ccc(Br)c(Cl)c2)c(C(=O)OC)c1C |
| InChI | InChI=1S/C16H14BrClN2O4S2/c1-7-11(14(21)23-2)13(26-12(7)15(22)24-3)20-16(25)19-8-4-5-9(17)10(18)6-8/h4-6H,1-3H3,(H2,19,20,25) |
| InChIKey | TYQVWEYDVCGPFY-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.79 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|