C18H20N2O5S2 — CID 19678195
dimethyl 5-[(4-methoxy-2-methylphenyl)carbamothioylamino]-3-methylthiophene-2,4-dicarboxylate (PubChem CID 19678195) has the molecular formula C18H20N2O5S2 and a molecular weight of 408.50 g/mol. Its IUPAC name is dimethyl 5-[(4-methoxy-2-methylphenyl)carbamothioylamino]-3-methylthiophene-2,4-dicarboxylate.
| Compound Name | dimethyl 5-[(4-methoxy-2-methylphenyl)carbamothioylamino]-3-methylthiophene-2,4-dicarboxylate |
|---|---|
| PubChem CID | 19678195 |
| Molecular Formula | C18H20N2O5S2 |
| Molecular Weight | 408.50 g/mol |
| Exact Mass | 408.08 |
| IUPAC Name | dimethyl 5-[(4-methoxy-2-methylphenyl)carbamothioylamino]-3-methylthiophene-2,4-dicarboxylate |
| SMILES | COC(=O)c1sc(NC(=S)Nc2ccc(OC)cc2C)c(C(=O)OC)c1C |
| InChI | InChI=1S/C18H20N2O5S2/c1-9-8-11(23-3)6-7-12(9)19-18(26)20-15-13(16(21)24-4)10(2)14(27-15)17(22)25-5/h6-8H,1-5H3,(H2,19,20,26) |
| InChIKey | OTMGWLPPFCDQLK-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 85.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.50 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|