C17H18N2O4S3 — CID 2211734
dimethyl 3-methyl-5-[(2-methylsulfanylphenyl)carbamothioylamino]thiophene-2,4-dicarboxylate (PubChem CID 2211734) has the molecular formula C17H18N2O4S3 and a molecular weight of 410.54 g/mol. Its IUPAC name is dimethyl 3-methyl-5-[(2-methylsulfanylphenyl)carbamothioylamino]thiophene-2,4-dicarboxylate.
| Compound Name | dimethyl 3-methyl-5-[(2-methylsulfanylphenyl)carbamothioylamino]thiophene-2,4-dicarboxylate |
|---|---|
| PubChem CID | 2211734 |
| Molecular Formula | C17H18N2O4S3 |
| Molecular Weight | 410.54 g/mol |
| Exact Mass | 410.04 |
| IUPAC Name | dimethyl 3-methyl-5-[(2-methylsulfanylphenyl)carbamothioylamino]thiophene-2,4-dicarboxylate |
| SMILES | COC(=O)c1sc(NC(=S)Nc2ccccc2SC)c(C(=O)OC)c1C |
| InChI | InChI=1S/C17H18N2O4S3/c1-9-12(15(20)22-2)14(26-13(9)16(21)23-3)19-17(24)18-10-7-5-6-8-11(10)25-4/h5-8H,1-4H3,(H2,18,19,24) |
| InChIKey | OOHPELQKEVJHHV-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.54 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|