C21H19Cl2N3O4S3 — CID 19678693
methyl 2-[[4-[(3,4-dichlorophenyl)sulfamoyl]phenyl]carbamothioylamino]-4,5-dimethylthiophene-3-carboxylate (PubChem CID 19678693) has the molecular formula C21H19Cl2N3O4S3 and a molecular weight of 544.51 g/mol. Its IUPAC name is methyl 2-[[4-[(3,4-dichlorophenyl)sulfamoyl]phenyl]carbamothioylamino]-4,5-dimethylthiophene-3-carboxylate.
| Compound Name | methyl 2-[[4-[(3,4-dichlorophenyl)sulfamoyl]phenyl]carbamothioylamino]-4,5-dimethylthiophene-3-carboxylate |
|---|---|
| PubChem CID | 19678693 |
| Molecular Formula | C21H19Cl2N3O4S3 |
| Molecular Weight | 544.51 g/mol |
| Exact Mass | 542.99 |
| IUPAC Name | methyl 2-[[4-[(3,4-dichlorophenyl)sulfamoyl]phenyl]carbamothioylamino]-4,5-dimethylthiophene-3-carboxylate |
| SMILES | COC(=O)c1c(NC(=S)Nc2ccc(S(=O)(=O)Nc3ccc(Cl)c(Cl)c3)cc2)sc(C)c1C |
| InChI | InChI=1S/C21H19Cl2N3O4S3/c1-11-12(2)32-19(18(11)20(27)30-3)25-21(31)24-13-4-7-15(8-5-13)33(28,29)26-14-6-9-16(22)17(23)10-14/h4-10,26H,1-3H3,(H2,24,25,31) |
| InChIKey | QVAPREJQNSOHMH-UHFFFAOYSA-N |
| XLogP | 6.07 |
| TPSA | 96.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.51 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|