C16H15Cl2N3O2S2 — CID 19678676
1-cyclopropyl-3-[4-[(3,4-dichlorophenyl)sulfamoyl]phenyl]thiourea (PubChem CID 19678676) has the molecular formula C16H15Cl2N3O2S2 and a molecular weight of 416.36 g/mol. Its IUPAC name is 1-cyclopropyl-3-[4-[(3,4-dichlorophenyl)sulfamoyl]phenyl]thiourea.
| Compound Name | 1-cyclopropyl-3-[4-[(3,4-dichlorophenyl)sulfamoyl]phenyl]thiourea |
|---|---|
| PubChem CID | 19678676 |
| Molecular Formula | C16H15Cl2N3O2S2 |
| Molecular Weight | 416.36 g/mol |
| Exact Mass | 415.00 |
| IUPAC Name | 1-cyclopropyl-3-[4-[(3,4-dichlorophenyl)sulfamoyl]phenyl]thiourea |
| SMILES | O=S(=O)(Nc1ccc(Cl)c(Cl)c1)c1ccc(NC(=S)NC2CC2)cc1 |
| InChI | InChI=1S/C16H15Cl2N3O2S2/c17-14-8-5-12(9-15(14)18)21-25(22,23)13-6-3-11(4-7-13)20-16(24)19-10-1-2-10/h3-10,21H,1-2H2,(H2,19,20,24) |
| InChIKey | PCNSWRWBYKFMAM-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.36 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|