C15H24N4O2S2 — CID 155518251
1-cyclopentyl-3-[4-[2-(methylamino)ethylsulfamoyl]phenyl]thiourea (PubChem CID 155518251) has the molecular formula C15H24N4O2S2 and a molecular weight of 356.52 g/mol. Its IUPAC name is 1-cyclopentyl-3-[4-[2-(methylamino)ethylsulfamoyl]phenyl]thiourea.
| Compound Name | 1-cyclopentyl-3-[4-[2-(methylamino)ethylsulfamoyl]phenyl]thiourea |
|---|---|
| PubChem CID | 155518251 |
| Molecular Formula | C15H24N4O2S2 |
| Molecular Weight | 356.52 g/mol |
| Exact Mass | 356.13 |
| IUPAC Name | 1-cyclopentyl-3-[4-[2-(methylamino)ethylsulfamoyl]phenyl]thiourea |
| SMILES | CNCCNS(=O)(=O)c1ccc(NC(=S)NC2CCCC2)cc1 |
| InChI | InChI=1S/C15H24N4O2S2/c1-16-10-11-17-23(20,21)14-8-6-13(7-9-14)19-15(22)18-12-4-2-3-5-12/h6-9,12,16-17H,2-5,10-11H2,1H3,(H2,18,19,22) |
| InChIKey | OMUAQCCJAWDRMO-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 82.26 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.52 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|