C27H30ClN5OS — CID 15954891
N-[4-[[4-[(1-benzylpiperidin-4-yl)amino]-3-chlorophenyl]carbamothioylamino]phenyl]acetamide (PubChem CID 15954891) has the molecular formula C27H30ClN5OS and a molecular weight of 508.09 g/mol. Its IUPAC name is N-[4-[[4-[(1-benzylpiperidin-4-yl)amino]-3-chlorophenyl]carbamothioylamino]phenyl]acetamide.
| Compound Name | N-[4-[[4-[(1-benzylpiperidin-4-yl)amino]-3-chlorophenyl]carbamothioylamino]phenyl]acetamide |
|---|---|
| PubChem CID | 15954891 |
| Molecular Formula | C27H30ClN5OS |
| Molecular Weight | 508.09 g/mol |
| Exact Mass | 507.19 |
| IUPAC Name | N-[4-[[4-[(1-benzylpiperidin-4-yl)amino]-3-chlorophenyl]carbamothioylamino]phenyl]acetamide |
| SMILES | CC(=O)Nc1ccc(NC(=S)Nc2ccc(NC3CCN(Cc4ccccc4)CC3)c(Cl)c2)cc1 |
| InChI | InChI=1S/C27H30ClN5OS/c1-19(34)29-21-7-9-22(10-8-21)31-27(35)32-24-11-12-26(25(28)17-24)30-23-13-15-33(16-14-23)18-20-5-3-2-4-6-20/h2-12,17,23,30H,13-16,18H2,1H3,(H,29,34)(H2,31,32,35) |
| InChIKey | WTBZYZHCLKQQTO-UHFFFAOYSA-N |
| XLogP | 6.18 |
| TPSA | 68.43 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.09 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|