C21H24ClN5O3S2 — CID 57102273
N-[4-[(4-acetamidophenyl)carbamoyl-sulfanylamino]-2-chlorophenyl]-2-thiomorpholin-4-ylacetamide (PubChem CID 57102273) has the molecular formula C21H24ClN5O3S2 and a molecular weight of 494.04 g/mol. Its IUPAC name is N-[4-[(4-acetamidophenyl)carbamoyl-sulfanylamino]-2-chlorophenyl]-2-thiomorpholin-4-ylacetamide.
| Compound Name | N-[4-[(4-acetamidophenyl)carbamoyl-sulfanylamino]-2-chlorophenyl]-2-thiomorpholin-4-ylacetamide |
|---|---|
| PubChem CID | 57102273 |
| Molecular Formula | C21H24ClN5O3S2 |
| Molecular Weight | 494.04 g/mol |
| Exact Mass | 493.10 |
| IUPAC Name | N-[4-[(4-acetamidophenyl)carbamoyl-sulfanylamino]-2-chlorophenyl]-2-thiomorpholin-4-ylacetamide |
| SMILES | CC(=O)Nc1ccc(NC(=O)N(S)c2ccc(NC(=O)CN3CCSCC3)c(Cl)c2)cc1 |
| InChI | InChI=1S/C21H24ClN5O3S2/c1-14(28)23-15-2-4-16(5-3-15)24-21(30)27(31)17-6-7-19(18(22)12-17)25-20(29)13-26-8-10-32-11-9-26/h2-7,12,31H,8-11,13H2,1H3,(H,23,28)(H,24,30)(H,25,29) |
| InChIKey | CJZKSMPXEDRGEA-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 93.78 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.04 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|