C22H19ClFN3O2S2 — CID 57111879
N-[4-[(3-chloro-4-methylsulfanylphenyl)carbamoyl-sulfanylamino]-2-methylphenyl]-2-fluorobenzamide (PubChem CID 57111879) has the molecular formula C22H19ClFN3O2S2 and a molecular weight of 476.00 g/mol. Its IUPAC name is N-[4-[(3-chloro-4-methylsulfanylphenyl)carbamoyl-sulfanylamino]-2-methylphenyl]-2-fluorobenzamide.
| Compound Name | N-[4-[(3-chloro-4-methylsulfanylphenyl)carbamoyl-sulfanylamino]-2-methylphenyl]-2-fluorobenzamide |
|---|---|
| PubChem CID | 57111879 |
| Molecular Formula | C22H19ClFN3O2S2 |
| Molecular Weight | 476.00 g/mol |
| Exact Mass | 475.06 |
| IUPAC Name | N-[4-[(3-chloro-4-methylsulfanylphenyl)carbamoyl-sulfanylamino]-2-methylphenyl]-2-fluorobenzamide |
| SMILES | CSc1ccc(NC(=O)N(S)c2ccc(NC(=O)c3ccccc3F)c(C)c2)cc1Cl |
| InChI | InChI=1S/C22H19ClFN3O2S2/c1-13-11-15(8-9-19(13)26-21(28)16-5-3-4-6-18(16)24)27(30)22(29)25-14-7-10-20(31-2)17(23)12-14/h3-12,30H,1-2H3,(H,25,29)(H,26,28) |
| InChIKey | WQTIHZPZTTWYGE-UHFFFAOYSA-N |
| XLogP | 6.65 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.00 |
| LogP ≤ 5 | 6.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|