C22H18ClF2N3O4S — CID 56987356
N-[4-[(5-chloro-2,4-dimethoxyphenyl)carbamoyl-sulfanylamino]phenyl]-2,3-difluorobenzamide (PubChem CID 56987356) has the molecular formula C22H18ClF2N3O4S and a molecular weight of 493.92 g/mol. Its IUPAC name is N-[4-[(5-chloro-2,4-dimethoxyphenyl)carbamoyl-sulfanylamino]phenyl]-2,3-difluorobenzamide.
| Compound Name | N-[4-[(5-chloro-2,4-dimethoxyphenyl)carbamoyl-sulfanylamino]phenyl]-2,3-difluorobenzamide |
|---|---|
| PubChem CID | 56987356 |
| Molecular Formula | C22H18ClF2N3O4S |
| Molecular Weight | 493.92 g/mol |
| Exact Mass | 493.07 |
| IUPAC Name | N-[4-[(5-chloro-2,4-dimethoxyphenyl)carbamoyl-sulfanylamino]phenyl]-2,3-difluorobenzamide |
| SMILES | COc1cc(OC)c(NC(=O)N(S)c2ccc(NC(=O)c3cccc(F)c3F)cc2)cc1Cl |
| InChI | InChI=1S/C22H18ClF2N3O4S/c1-31-18-11-19(32-2)17(10-15(18)23)27-22(30)28(33)13-8-6-12(7-9-13)26-21(29)14-4-3-5-16(24)20(14)25/h3-11,33H,1-2H3,(H,26,29)(H,27,30) |
| InChIKey | PIJNMTAMGZQLJO-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.92 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|