C22H18ClF2N3O3S — CID 15954730
N-[4-[(5-chloro-2,4-dimethoxyphenyl)carbamothioylamino]phenyl]-2,5-difluorobenzamide (PubChem CID 15954730) has the molecular formula C22H18ClF2N3O3S and a molecular weight of 477.92 g/mol. Its IUPAC name is N-[4-[(5-chloro-2,4-dimethoxyphenyl)carbamothioylamino]phenyl]-2,5-difluorobenzamide.
| Compound Name | N-[4-[(5-chloro-2,4-dimethoxyphenyl)carbamothioylamino]phenyl]-2,5-difluorobenzamide |
|---|---|
| PubChem CID | 15954730 |
| Molecular Formula | C22H18ClF2N3O3S |
| Molecular Weight | 477.92 g/mol |
| Exact Mass | 477.07 |
| IUPAC Name | N-[4-[(5-chloro-2,4-dimethoxyphenyl)carbamothioylamino]phenyl]-2,5-difluorobenzamide |
| SMILES | COc1cc(OC)c(NC(=S)Nc2ccc(NC(=O)c3cc(F)ccc3F)cc2)cc1Cl |
| InChI | InChI=1S/C22H18ClF2N3O3S/c1-30-19-11-20(31-2)18(10-16(19)23)28-22(32)27-14-6-4-13(5-7-14)26-21(29)15-9-12(24)3-8-17(15)25/h3-11H,1-2H3,(H,26,29)(H2,27,28,32) |
| InChIKey | BTTOGBRQNBPLHZ-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 71.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.92 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|