C23H22ClN3O4S — CID 15954708
N-[4-[(5-chloro-2,4-dimethoxyphenyl)carbamothioylamino]phenyl]-3-methoxybenzamide (PubChem CID 15954708) has the molecular formula C23H22ClN3O4S and a molecular weight of 471.97 g/mol. Its IUPAC name is N-[4-[(5-chloro-2,4-dimethoxyphenyl)carbamothioylamino]phenyl]-3-methoxybenzamide.
| Compound Name | N-[4-[(5-chloro-2,4-dimethoxyphenyl)carbamothioylamino]phenyl]-3-methoxybenzamide |
|---|---|
| PubChem CID | 15954708 |
| Molecular Formula | C23H22ClN3O4S |
| Molecular Weight | 471.97 g/mol |
| Exact Mass | 471.10 |
| IUPAC Name | N-[4-[(5-chloro-2,4-dimethoxyphenyl)carbamothioylamino]phenyl]-3-methoxybenzamide |
| SMILES | COc1cccc(C(=O)Nc2ccc(NC(=S)Nc3cc(Cl)c(OC)cc3OC)cc2)c1 |
| InChI | InChI=1S/C23H22ClN3O4S/c1-29-17-6-4-5-14(11-17)22(28)25-15-7-9-16(10-8-15)26-23(32)27-19-12-18(24)20(30-2)13-21(19)31-3/h4-13H,1-3H3,(H,25,28)(H2,26,27,32) |
| InChIKey | IBGCSGJHYCRMKX-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 80.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.97 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|