C26H29ClN4O4S — CID 15954795
N-[4-[(5-chloro-2,4-dimethoxyphenyl)carbamothioylamino]phenyl]-3-[2-(dimethylamino)ethoxy]benzamide (PubChem CID 15954795) has the molecular formula C26H29ClN4O4S and a molecular weight of 529.06 g/mol. Its IUPAC name is N-[4-[(5-chloro-2,4-dimethoxyphenyl)carbamothioylamino]phenyl]-3-[2-(dimethylamino)ethoxy]benzamide.
| Compound Name | N-[4-[(5-chloro-2,4-dimethoxyphenyl)carbamothioylamino]phenyl]-3-[2-(dimethylamino)ethoxy]benzamide |
|---|---|
| PubChem CID | 15954795 |
| Molecular Formula | C26H29ClN4O4S |
| Molecular Weight | 529.06 g/mol |
| Exact Mass | 528.16 |
| IUPAC Name | N-[4-[(5-chloro-2,4-dimethoxyphenyl)carbamothioylamino]phenyl]-3-[2-(dimethylamino)ethoxy]benzamide |
| SMILES | COc1cc(OC)c(NC(=S)Nc2ccc(NC(=O)c3cccc(OCCN(C)C)c3)cc2)cc1Cl |
| InChI | InChI=1S/C26H29ClN4O4S/c1-31(2)12-13-35-20-7-5-6-17(14-20)25(32)28-18-8-10-19(11-9-18)29-26(36)30-22-15-21(27)23(33-3)16-24(22)34-4/h5-11,14-16H,12-13H2,1-4H3,(H,28,32)(H2,29,30,36) |
| InChIKey | SMICJXSJCJUHCM-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 84.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.06 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|