C22H19ClFN3O4S — CID 57012982
N-[4-[(5-chloro-2,4-dimethoxyphenyl)carbamoyl-sulfanylamino]phenyl]-3-fluorobenzamide (PubChem CID 57012982) has the molecular formula C22H19ClFN3O4S and a molecular weight of 475.93 g/mol. Its IUPAC name is N-[4-[(5-chloro-2,4-dimethoxyphenyl)carbamoyl-sulfanylamino]phenyl]-3-fluorobenzamide.
| Compound Name | N-[4-[(5-chloro-2,4-dimethoxyphenyl)carbamoyl-sulfanylamino]phenyl]-3-fluorobenzamide |
|---|---|
| PubChem CID | 57012982 |
| Molecular Formula | C22H19ClFN3O4S |
| Molecular Weight | 475.93 g/mol |
| Exact Mass | 475.08 |
| IUPAC Name | N-[4-[(5-chloro-2,4-dimethoxyphenyl)carbamoyl-sulfanylamino]phenyl]-3-fluorobenzamide |
| SMILES | COc1cc(OC)c(NC(=O)N(S)c2ccc(NC(=O)c3cccc(F)c3)cc2)cc1Cl |
| InChI | InChI=1S/C22H19ClFN3O4S/c1-30-19-12-20(31-2)18(11-17(19)23)26-22(29)27(32)16-8-6-15(7-9-16)25-21(28)13-4-3-5-14(24)10-13/h3-12,32H,1-2H3,(H,25,28)(H,26,29) |
| InChIKey | UAZKEFWDZQGUDQ-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.93 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|