C24H23ClFN3O6S — CID 57279419
N-[4-[(5-chloro-2,4-dimethoxyphenyl)carbamoyl-sulfanylamino]-2,5-dimethoxyphenyl]-2-fluorobenzamide (PubChem CID 57279419) has the molecular formula C24H23ClFN3O6S and a molecular weight of 535.98 g/mol. Its IUPAC name is N-[4-[(5-chloro-2,4-dimethoxyphenyl)carbamoyl-sulfanylamino]-2,5-dimethoxyphenyl]-2-fluorobenzamide.
| Compound Name | N-[4-[(5-chloro-2,4-dimethoxyphenyl)carbamoyl-sulfanylamino]-2,5-dimethoxyphenyl]-2-fluorobenzamide |
|---|---|
| PubChem CID | 57279419 |
| Molecular Formula | C24H23ClFN3O6S |
| Molecular Weight | 535.98 g/mol |
| Exact Mass | 535.10 |
| IUPAC Name | N-[4-[(5-chloro-2,4-dimethoxyphenyl)carbamoyl-sulfanylamino]-2,5-dimethoxyphenyl]-2-fluorobenzamide |
| SMILES | COc1cc(OC)c(NC(=O)N(S)c2cc(OC)c(NC(=O)c3ccccc3F)cc2OC)cc1Cl |
| InChI | InChI=1S/C24H23ClFN3O6S/c1-32-19-12-21(34-3)16(9-14(19)25)28-24(31)29(36)18-11-20(33-2)17(10-22(18)35-4)27-23(30)13-7-5-6-8-15(13)26/h5-12,36H,1-4H3,(H,27,30)(H,28,31) |
| InChIKey | OGYOYHYIORXCMU-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 98.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.98 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|