C17H17Cl2N3O5S — CID 57164250
N-[5-chloro-4-[(5-chloro-2,4-dimethoxyphenyl)carbamoyl-sulfanylamino]-2-hydroxyphenyl]acetamide (PubChem CID 57164250) has the molecular formula C17H17Cl2N3O5S and a molecular weight of 446.31 g/mol. Its IUPAC name is N-[5-chloro-4-[(5-chloro-2,4-dimethoxyphenyl)carbamoyl-sulfanylamino]-2-hydroxyphenyl]acetamide.
| Compound Name | N-[5-chloro-4-[(5-chloro-2,4-dimethoxyphenyl)carbamoyl-sulfanylamino]-2-hydroxyphenyl]acetamide |
|---|---|
| PubChem CID | 57164250 |
| Molecular Formula | C17H17Cl2N3O5S |
| Molecular Weight | 446.31 g/mol |
| Exact Mass | 445.03 |
| IUPAC Name | N-[5-chloro-4-[(5-chloro-2,4-dimethoxyphenyl)carbamoyl-sulfanylamino]-2-hydroxyphenyl]acetamide |
| SMILES | COc1cc(OC)c(NC(=O)N(S)c2cc(O)c(NC(C)=O)cc2Cl)cc1Cl |
| InChI | InChI=1S/C17H17Cl2N3O5S/c1-8(23)20-11-4-9(18)13(6-14(11)24)22(28)17(25)21-12-5-10(19)15(26-2)7-16(12)27-3/h4-7,24,28H,1-3H3,(H,20,23)(H,21,25) |
| InChIKey | QVEMIAYZTCVXDH-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 100.13 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.31 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|